cas: 1533-20-6 — see every product listed under this CAS number, including other names
1,3-Diphenylbutan-1-one, 95%(GC-MS),RG, 95%(GC-MS),RG (CAS 1533-20-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DKW-100mg |
| cas | 1533-20-6 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 654.80 Pln |
| purity | 95%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1,3-diphenylbutan-1-one (CAS 1533-20-6) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 1,3-diphenylbutan-1-one. InChIKey: GIVFXLVPKFXTCU-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1,3-diphenylbutan-1-one |
| InChIKey | GIVFXLVPKFXTCU-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)