cas: 64728-49-0 — see every product listed under this CAS number, including other names
1,4-Di(pyridin-2-yl)piperazine, 97%, 97% (CAS 64728-49-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAL9-250mg |
| cas | 64728-49-0 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2022.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,4-dipyridin-2-ylpiperazine (CAS 64728-49-0) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 1,4-dipyridin-2-ylpiperazine. InChIKey: GMNOIEBLHFKZLT-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,4-dipyridin-2-ylpiperazine |
| InChIKey | GMNOIEBLHFKZLT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)