cas: 83-53-4 — see every product listed under this CAS number, including other names
1,4-Dibromonaphthalene 98% (CAS 83-53-4) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104918-1000g |
| cas | 83-53-4 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2589.81 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1332.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A104918 |
1,4-dibromonaphthalene (CAS 83-53-4) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,4-dibromonaphthalene. InChIKey: IBGUDZMIAZLJNY-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,4-dibromonaphthalene |
| InChIKey | IBGUDZMIAZLJNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)Br |
Computed by PubChem (NCBI)