CAS 19125-84-9 appears in our catalog under these names: 1,6-Dibromonaphthalene 95%, 1,6-Dibromonaphthalene, 95%, 95%, 1,6-DIBROMONAPHTHALENE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1,6-dibromonaphthalene (CAS 19125-84-9) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,6-dibromonaphthalene. InChIKey: PUIAXCYSKMFFOU-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,6-dibromonaphthalene |
| InChIKey | PUIAXCYSKMFFOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C(=C1)Br |
Computed by PubChem (NCBI)