CAS 83-53-4 appears in our catalog under these names: 1,4-Dibromonaphthalene, >95% (HPLC), 1,4-Dibromonapthalene, 1,4–Dibromonaphthalene, 1,4-Dibromonaphthalene, 98% , 1,4-Dibromonaphthalene, >98.0%(GC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 25g, 100mg, 100g, 5g, 1000g, 1g, 500g.
1,4-dibromonaphthalene (CAS 83-53-4) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,4-dibromonaphthalene. InChIKey: IBGUDZMIAZLJNY-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,4-dibromonaphthalene |
| InChIKey | IBGUDZMIAZLJNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)Br |
Computed by PubChem (NCBI)