CAS 14658-95-8 appears in our catalog under these names: 1,3-Dibromoazulene, 95%, 1,3-Dibromoazulene, 98% GC, 1,3–Dibromoazulene, 1,3-Dibromoazulene, >98.0%(GC), 1,3-Dibromoazulene. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 200mg, 50mg.
1,3-dibromoazulene (CAS 14658-95-8) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,3-dibromoazulene. InChIKey: OEXLRDNVSRMWHO-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,3-dibromoazulene |
| InChIKey | OEXLRDNVSRMWHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C(C=C2Br)Br)C=C1 |
Computed by PubChem (NCBI)