CAS 17135-74-9 appears in our catalog under these names: 1,8–Dibromonaphthalene, 1,8-Dibromonaphthalene, 1,8-Dibromonaphthalene, >98.0%(GC), 1,8-Dibromonaphthalene 98%, 1,8-DIBROMONAPHTHALENE, 97%. Offered by: GLPBio, Chemat, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 1g, 1000g, 250mg, 10g, 500g.
1,8-dibromonaphthalene (CAS 17135-74-9) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,8-dibromonaphthalene. InChIKey: DLXBGTIGAIESIG-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,8-dibromonaphthalene |
| InChIKey | DLXBGTIGAIESIG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CC=C2)Br |
Computed by PubChem (NCBI)