cas: 202823-67-4 — see every product listed under this CAS number, including other names
1,4-Dichloro-5,6,7,8-tetrahydro-5,8-ethanophthalazine, ≥97%, ≥97% (CAS 202823-67-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1139G6-100mg |
| cas | 202823-67-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 5g | 2267.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
3,6-dichloro-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (CAS 202823-67-4) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 3,6-dichloro-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene. InChIKey: GZIFYLGNTOAIJJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 3,6-dichloro-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| InChIKey | GZIFYLGNTOAIJJ-UHFFFAOYSA-N |
| SMILES | C1CC2CCC1C3=C2C(=NN=C3Cl)Cl |
Computed by PubChem (NCBI)