1,4-Phenylene diacrylate, 97%
cas: 6729-79-9 — see every product listed under this CAS number, including other names
1,4-Phenylene diacrylate, 97% (CAS 6729-79-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A598197-100mg |
| cas | 6729-79-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 615.13 Pln | |
| Ambeed | 5g | 2662.12 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 698.00 Pln | |
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 658.68 Pln | |
| BLDpharm | 5g | 2863.46 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-prop-2-enoyloxyphenyl) prop-2-enoate (CAS 6729-79-9) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: (4-prop-2-enoyloxyphenyl) prop-2-enoate. InChIKey: JMMVHMOAIMOMOF-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (4-prop-2-enoyloxyphenyl) prop-2-enoate |
| InChIKey | JMMVHMOAIMOMOF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC=C(C=C1)OC(=O)C=C |
Computed by PubChem (NCBI)
Synonyms:
1,4-Phenylene diacrylate, (4-prop-2-enoyloxyphenyl) prop-2-enoate, p-phenylene diacrylate, 1,4-phenylene bisacrylate, hydroquinone diacrylate, Benzene-1,4-diol diacrylate, Bisacrylic acid p-phenylene ester, Bis(acrylic acid)p-phenylene ester, Bisacrylic acid benzene-1,4-diyl ester, 1,4-Phenylene diprop-2-enoate