Products 50402-83-0
CAS 50402-83-0 appears in our catalog under these names: (7-Methyl-2-oxo-2h-chromen-4-yl)acetic acid, 95%, 2-(7-methyl-2-oxo-2H-chromen-4-yl)acetic Acid, >95% (HPLC), (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid, (7-methyl-2-oxo-2H-chromen-4-yl)acetic acid, ≥95%, ≥95%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 5g, 1g, 2,5g, 250mg, 500mg.
2-(7-methyl-2-oxochromen-4-yl)acetic acid (CAS 50402-83-0) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 2-(7-methyl-2-oxochromen-4-yl)acetic acid. InChIKey: VDQLZKYCWITDPF-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-(7-methyl-2-oxochromen-4-yl)acetic acid |
| InChIKey | VDQLZKYCWITDPF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC(=O)O2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(7-Methyl-2-oxo-2H-1-benzopyran-4-yl)acetic acid, 2-(7-methyl-2-oxo-2H-chromen-4-yl)acetic acid, (7-methyl-2-oxo-2H-chromen-4-yl)acetic acid, 2-(7-methyl-2-oxochromen-4-yl)acetic acid, 2H-1-Benzopyran-4-acetic acid, 7-methyl-2-oxo-, 2-(7-methyl-2-oxo-chromen-4-yl)acetic acid, 7-methylcoumarin-4-acetic acid, Oprea1_101016, Oprea1_386960, CBDivE_000106