CAS 5527-91-3 appears in our catalog under these names: 6-ethyl-4-oxochromene-2-carboxylic acid, 98%, 6-Ethylchromone-2-carboxylic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
6-ethyl-4-oxochromene-2-carboxylic acid (CAS 5527-91-3) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 6-ethyl-4-oxochromene-2-carboxylic acid. InChIKey: IUJCKZLNEJLXBC-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 6-ethyl-4-oxochromene-2-carboxylic acid |
| InChIKey | IUJCKZLNEJLXBC-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)