Products 288399-57-5
CAS 288399-57-5 appears in our catalog under these names: 6,8-Dimethylchromone-2-carboxylic acid, 98%, 6,8-Dimethyl-4-oxo-4H-chromene-2-carboxylic acid, 95+%, 6,8-Dimethylchromone-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg.
6,8-dimethyl-4-oxochromene-2-carboxylic acid (CAS 288399-57-5) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 6,8-dimethyl-4-oxochromene-2-carboxylic acid. InChIKey: PQUJCDXKEIHDCF-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 6,8-dimethyl-4-oxochromene-2-carboxylic acid |
| InChIKey | PQUJCDXKEIHDCF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C=C(O2)C(=O)O)C |
Computed by PubChem (NCBI)