Products 52938-99-5

CAS 52938-99-5 is the registry number for 5-(4-Methoxyphenyl)-2-furoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-(4-methoxyphenyl)furan-2-carboxylic acid (CAS 52938-99-5) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 5-(4-methoxyphenyl)furan-2-carboxylic acid. InChIKey: YEBLYHKPTQJGEC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O4
Molecular weight218.20 g/mol
IUPAC name5-(4-methoxyphenyl)furan-2-carboxylic acid
InChIKeyYEBLYHKPTQJGEC-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)