1,5-DIBROMONAPHTHALENE, 98%, 98%
cas: 7351-74-8 — see every product listed under this CAS number, including other names
1,5-DIBROMONAPHTHALENE, 98%, 98% (CAS 7351-74-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DQ4-250mg |
| cas | 7351-74-8 |
| size | 250mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 50g | 1370.00 Pln | |
| Chemat | 100g | 2406.80 Pln | |
| Chemat | 250g | 5574.80 Pln | |
| Chemat | 500g | 7507.20 Pln | |
| Chemat | 1kg | 11248.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,5-dibromonaphthalene (CAS 7351-74-8) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,5-dibromonaphthalene. InChIKey: CZYAFTZIQWCKOI-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,5-dibromonaphthalene |
| InChIKey | CZYAFTZIQWCKOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)Br |
Computed by PubChem (NCBI)