CAS 20027-95-6 appears in our catalog under these names: 1,5–Dibromo–2,6–dimethylnaphthalene, 1,5-Dibromo-2,6-dimethylnaphthalene, 96%, 96%, 1,5-Dibromo-2,6-dimethyl-naphthalene, 97%, 1,5-Dibromo-2,6-dimethylnaphthalene, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,5-dibromo-2,6-dimethylnaphthalene (CAS 20027-95-6) is a chemical compound with the molecular formula C12H10Br2 and a molecular weight of 314.01 g/mol. IUPAC name: 1,5-dibromo-2,6-dimethylnaphthalene. InChIKey: CJCKXYUJTNKMQF-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2 |
|---|---|
| Molecular weight | 314.01 g/mol |
| IUPAC name | 1,5-dibromo-2,6-dimethylnaphthalene |
| InChIKey | CJCKXYUJTNKMQF-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=C(C=C2)C)Br)Br |
Computed by PubChem (NCBI)