Products 59882-98-3

CAS 59882-98-3 appears in our catalog under these names: 1,2-Bis(bromomethyl)naphthalene 95%, NAPHTHALENE, 1,2-BIS(BROMOMETHYL)-, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

1,2-bis(bromomethyl)naphthalene (CAS 59882-98-3) is a chemical compound with the molecular formula C12H10Br2 and a molecular weight of 314.01 g/mol. IUPAC name: 1,2-bis(bromomethyl)naphthalene. InChIKey: FONHMGXRXCPGMD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10Br2
Molecular weight314.01 g/mol
IUPAC name1,2-bis(bromomethyl)naphthalene
InChIKeyFONHMGXRXCPGMD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC(=C2CBr)CBr

Computed by PubChem (NCBI)