CAS 59882-98-3 appears in our catalog under these names: 1,2-Bis(bromomethyl)naphthalene 95%, NAPHTHALENE, 1,2-BIS(BROMOMETHYL)-, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg.
1,2-bis(bromomethyl)naphthalene (CAS 59882-98-3) is a chemical compound with the molecular formula C12H10Br2 and a molecular weight of 314.01 g/mol. IUPAC name: 1,2-bis(bromomethyl)naphthalene. InChIKey: FONHMGXRXCPGMD-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2 |
|---|---|
| Molecular weight | 314.01 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)naphthalene |
| InChIKey | FONHMGXRXCPGMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2CBr)CBr |
Computed by PubChem (NCBI)