cas: 1251014-54-6 — see every product listed under this CAS number, including other names
1,5-Naphthyridine-1,6(2H)-dicarboxylic acid, 3,4-dihydro-, 1-(1,1-dimethylethyl) 6-methyl ester, 97%, 97% (CAS 1251014-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HI2V-100mg |
| cas | 1251014-54-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1010.00 Pln | |
| Chemat | 250mg | 1845.20 Pln | |
| Chemat | 1g | 3712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate (CAS 1251014-54-6) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate. InChIKey: OJWKXBLNHUDMNU-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate |
| InChIKey | OJWKXBLNHUDMNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=CC(=N2)C(=O)OC |
Computed by PubChem (NCBI)