CAS 1251014-54-6 appears in our catalog under these names: 1-tert-Butyl 6-methyl 1,2,3,4-tetrahydro-1,5-naphthyridine-1,6-dicarboxylate, 95%, 1–tert–Butyl 6–methyl 3,4–dihydro–1,5–naphthyridine–1,6(2H)–dicarboxylate, 1,5-Naphthyridine-1,6(2H)-dicarboxylic acid, 3,4-dihydro-, 1-(1,1-dimethylethyl) 6-methyl ester, 97%, 97%, 1-O-tert-Butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
1-O-tert-butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate (CAS 1251014-54-6) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate. InChIKey: OJWKXBLNHUDMNU-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 3,4-dihydro-2H-1,5-naphthyridine-1,6-dicarboxylate |
| InChIKey | OJWKXBLNHUDMNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=CC(=N2)C(=O)OC |
Computed by PubChem (NCBI)