cas: 306935-83-1 — see every product listed under this CAS number, including other names
1,5-dichloro-2-isothiocyanato-3-methylbenzene (CAS 306935-83-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F518987-1G |
| cas | 306935-83-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln |
| delivery time | 1-2 weeks |
|---|
1,5-dichloro-2-isothiocyanato-3-methylbenzene (CAS 306935-83-1) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 1,5-dichloro-2-isothiocyanato-3-methylbenzene. InChIKey: INEPHFOQAAZPOE-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 1,5-dichloro-2-isothiocyanato-3-methylbenzene |
| InChIKey | INEPHFOQAAZPOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N=C=S)Cl)Cl |
Computed by PubChem (NCBI)