CAS 306935-83-1 appears in our catalog under these names: 2,4-Dichloro-6-methylphenyl isothiocyanate, 95%, 1,5-dichloro-2-isothiocyanato-3-methylbenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1,5-dichloro-2-isothiocyanato-3-methylbenzene (CAS 306935-83-1) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 1,5-dichloro-2-isothiocyanato-3-methylbenzene. InChIKey: INEPHFOQAAZPOE-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 1,5-dichloro-2-isothiocyanato-3-methylbenzene |
| InChIKey | INEPHFOQAAZPOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N=C=S)Cl)Cl |
Computed by PubChem (NCBI)