CAS 40671-25-8 is the registry number for 4,5-Dichloro-2-methylbenzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-2-methyl-1,3-benzothiazole (CAS 40671-25-8) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 4,5-dichloro-2-methyl-1,3-benzothiazole. InChIKey: KHDXWYMBFKGSHM-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 4,5-dichloro-2-methyl-1,3-benzothiazole |
| InChIKey | KHDXWYMBFKGSHM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2Cl)Cl |
Computed by PubChem (NCBI)