CAS 1036587-85-5 appears in our catalog under these names: 1,3-Dichloro-2-isothiocyanato-4-methylbenzene, 95%, 1,3-Dichloro-2-isothiocyanato-4-methylbenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1,3-dichloro-2-isothiocyanato-4-methylbenzene (CAS 1036587-85-5) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 1,3-dichloro-2-isothiocyanato-4-methylbenzene. InChIKey: OFERGZYJXXNVDN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 1,3-dichloro-2-isothiocyanato-4-methylbenzene |
| InChIKey | OFERGZYJXXNVDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)N=C=S)Cl |
Computed by PubChem (NCBI)