CAS 110704-19-3 appears in our catalog under these names: 5-Chloro-2-(chloromethyl)benzo(d)thiazole, 98%, 5-Chloro-2-(chloromethyl)-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 25mg, 1g, 0,5g, 50mg.
5-chloro-2-(chloromethyl)-1,3-benzothiazole (CAS 110704-19-3) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 5-chloro-2-(chloromethyl)-1,3-benzothiazole. InChIKey: LNZBRKLHATUCPG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 5-chloro-2-(chloromethyl)-1,3-benzothiazole |
| InChIKey | LNZBRKLHATUCPG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(S2)CCl |
Computed by PubChem (NCBI)