1,8-Dibromonaphthalene, 98%
cas: 17135-74-9 — see every product listed under this CAS number, including other names
1,8-Dibromonaphthalene, 98% (CAS 17135-74-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A410357-250mg |
| cas | 17135-74-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1165.81 Pln | |
| Ambeed | 500g | 5543.50 Pln | |
| Ambeed | 1kg | 8825.38 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 219.95 Pln | |
| BLDpharm | 10g | 253.27 Pln | |
| BLDpharm | 25g | 364.34 Pln | |
| BLDpharm | 100g | 1252.92 Pln | |
| BLDpharm | 500g | 5967.92 Pln | |
| BLDpharm | 1kg | 9511.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,8-dibromonaphthalene (CAS 17135-74-9) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 1,8-dibromonaphthalene. InChIKey: DLXBGTIGAIESIG-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 1,8-dibromonaphthalene |
| InChIKey | DLXBGTIGAIESIG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CC=C2)Br |
Computed by PubChem (NCBI)
