cas: 849217-48-7 — see every product listed under this CAS number, including other names
1-((4-Fluorophenyl)carbamoyl)cyclopropanecarboxylic acid, 98% (CAS 849217-48-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211163-5G |
| cas | 849217-48-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 482.14 Pln | |
| Fluorochem | 500g | 2132.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 849217-48-7) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: PFMAFXYUHZDKPY-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | PFMAFXYUHZDKPY-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)