CAS 1998-86-3 is the registry number for 1-(2-Fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 100g, 500g.
1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 1998-86-3) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: SPNFIZUVZRKIQZ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | SPNFIZUVZRKIQZ-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)