CAS 849217-48-7 appears in our catalog under these names: 1-((4-Fluorophenyl)carbamoyl)cyclopropanecarboxylic acid, 97%, Cabozantinib Impurity 6, Cabozantinib Impurity 39(Cabozantinib Hydroxy Impurity), 1-((4-Fluorophenyl)carbamoyl)cyclopropanecarboxylic Acid, >95% (HPLC), 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic Acid, >98.0%(HPLC)(T). Offered by: Combi-blocks, Chemat Brand, TRC, TCI, Ambeed. Available pack sizes: 1g, 5g, 100g, 25g, on request, 250mg, 500mg, 1000g.
1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 849217-48-7) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: PFMAFXYUHZDKPY-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | PFMAFXYUHZDKPY-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)