Products 1206970-40-2
CAS 1206970-40-2 is the registry number for 3-(6-Fluoro-1-oxoisoindolin-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
3-(5-fluoro-3-oxo-1H-isoindol-2-yl)propanoic acid (CAS 1206970-40-2) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 3-(5-fluoro-3-oxo-1H-isoindol-2-yl)propanoic acid. InChIKey: KHFRWQUDKMMYCA-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 3-(5-fluoro-3-oxo-1H-isoindol-2-yl)propanoic acid |
| InChIKey | KHFRWQUDKMMYCA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)F)C(=O)N1CCC(=O)O |
Computed by PubChem (NCBI)