CAS 1951441-50-1 is the registry number for 4-Fluoro-3,3-dimethyl-7-nitro-indan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-fluoro-3,3-dimethyl-7-nitro-2H-inden-1-one (CAS 1951441-50-1) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 4-fluoro-3,3-dimethyl-7-nitro-2H-inden-1-one. InChIKey: LCXQUUPKMMRGTR-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 4-fluoro-3,3-dimethyl-7-nitro-2H-inden-1-one |
| InChIKey | LCXQUUPKMMRGTR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(C=CC(=C21)F)[N+](=O)[O-])C |
Computed by PubChem (NCBI)