cas: 2006277-62-7 — see every product listed under this CAS number, including other names
1-(1,1-Dimethylethyl) 4-methyl 3-bromo-1H-indole-1,4-dicarboxylate, ≥95%, ≥95% (CAS 2006277-62-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IM0L-1g |
| cas | 2006277-62-7 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 659.60 Pln | |
| Chemat | 5g | 1797.20 Pln | |
| Chemat | 10g | 3285.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 4-O-methyl 3-bromoindole-1,4-dicarboxylate (CAS 2006277-62-7) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 3-bromoindole-1,4-dicarboxylate. InChIKey: DFMGVCNPSRZXRN-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 3-bromoindole-1,4-dicarboxylate |
| InChIKey | DFMGVCNPSRZXRN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C(C=CC=C21)C(=O)OC)Br |
Computed by PubChem (NCBI)