CAS 479552-81-3 appears in our catalog under these names: 1-tert-Butyl 6-methyl 3-bromo-1h-indole-1,6-dicarboxylate, 95%, 1-tert-Butyl 6-methyl 3-bromo-1H-indole-1,6-dicarboxylate 95%, 1-Tert-Butyl 6-Methyl 3-Bromo-1H-Indole-1,6-Dicarboxylate, 95%, 95%, 1-tert-Butyl 6-methyl 3-bromo-1H-indole-1,6-dicarboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
1-O-tert-butyl 6-O-methyl 3-bromoindole-1,6-dicarboxylate (CAS 479552-81-3) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 3-bromoindole-1,6-dicarboxylate. InChIKey: QGSWCWANVQUOBH-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 3-bromoindole-1,6-dicarboxylate |
| InChIKey | QGSWCWANVQUOBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)