CAS 1100052-64-9 appears in our catalog under these names: 1-tert-Butyl 3-methyl 5-bromo-1h-indole-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-methyl 5-bromo-1H-indole-1,3-dicarboxylate, 97%, 1-tert-Butyl 3-methyl 5-bromo-1H-indole-1,3-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
1-O-tert-butyl 3-O-methyl 5-bromoindole-1,3-dicarboxylate (CAS 1100052-64-9) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-bromoindole-1,3-dicarboxylate. InChIKey: WUAKVCRJIPQNOK-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-bromoindole-1,3-dicarboxylate |
| InChIKey | WUAKVCRJIPQNOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)Br)C(=O)OC |
Computed by PubChem (NCBI)