Products 1440807-02-2
CAS 1440807-02-2 is the registry number for 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-methyl 6-bromoindole-1,4-dicarboxylate (CAS 1440807-02-2) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 6-bromoindole-1,4-dicarboxylate. InChIKey: IGNOOYDYYHQTEW-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 6-bromoindole-1,4-dicarboxylate |
| InChIKey | IGNOOYDYYHQTEW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C(C=C(C=C21)Br)C(=O)OC |
Computed by PubChem (NCBI)