CAS 479552-82-4 appears in our catalog under these names: 1-(tert-Butyl) 5-methyl 3-bromo-1h-indole-1,5-dicarboxylate, 95%, 1-(TERT-BUTYL) 5-METHYL 3-BROMO-1H-INDOLE-1,5-DICARBOXYLATE, ≥95%, ≥95%, 1-(TERT-BUTYL) 5-METHYL 3-BROMO-1H-INDOLE-1,5-DICARBOXYLATE. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate (CAS 479552-82-4) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate. InChIKey: KGLJNKRRIRJQBS-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate |
| InChIKey | KGLJNKRRIRJQBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)