cas: 383136-31-0 — see every product listed under this CAS number, including other names
1-(1,3-thiazol-2-yl)-1H-pyrrole-2-carbaldehyde, 98% (CAS 383136-31-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F313729-100MG |
| cas | 383136-31-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 1580.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(1,3-thiazol-2-yl)pyrrole-2-carbaldehyde (CAS 383136-31-0) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 1-(1,3-thiazol-2-yl)pyrrole-2-carbaldehyde. InChIKey: MJMPLOXIKWGERX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1-(1,3-thiazol-2-yl)pyrrole-2-carbaldehyde |
| InChIKey | MJMPLOXIKWGERX-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=NC=CS2 |
Computed by PubChem (NCBI)