CAS 75465-37-1 is the registry number for 3-Phenyl-1,2,4-thiadiazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-phenyl-4H-1,2,4-thiadiazol-5-one (CAS 75465-37-1) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 3-phenyl-4H-1,2,4-thiadiazol-5-one. InChIKey: RPGVJHOPAAGFGC-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 3-phenyl-4H-1,2,4-thiadiazol-5-one |
| InChIKey | RPGVJHOPAAGFGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=O)N2 |
Computed by PubChem (NCBI)