CAS 3004-42-0 appears in our catalog under these names: 5-Phenyl-1,3,4-oxadiazole-2-thiol, 95%, 5-Phenyl-1,3,4-oxadiazole-2(3H)-thione, 98+%, 98+%, 5-Phenyl-1,3,4-oxadiazole-2-thiol, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100g.
5-phenyl-3H-1,3,4-oxadiazole-2-thione (CAS 3004-42-0) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 5-phenyl-3H-1,3,4-oxadiazole-2-thione. InChIKey: FOHWXVBZGSVUGO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 5-phenyl-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | FOHWXVBZGSVUGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)