CAS 29198-43-4 appears in our catalog under these names: 2-Benzothiazolecarboxamide, 98%, 2–Benzothiazolecarboxamide, 2-Benzothiazolecarboxamide, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
1,3-benzothiazole-2-carboxamide (CAS 29198-43-4) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 1,3-benzothiazole-2-carboxamide. InChIKey: LYASTVLDAJIXBL-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1,3-benzothiazole-2-carboxamide |
| InChIKey | LYASTVLDAJIXBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(=O)N |
Computed by PubChem (NCBI)