CAS 383136-31-0 is the registry number for 1-(1,3-Thiazol-2-yl)-1h-pyrrole-2-carbaldehyde, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
1-(1,3-thiazol-2-yl)pyrrole-2-carbaldehyde (CAS 383136-31-0) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 1-(1,3-thiazol-2-yl)pyrrole-2-carbaldehyde. InChIKey: MJMPLOXIKWGERX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1-(1,3-thiazol-2-yl)pyrrole-2-carbaldehyde |
| InChIKey | MJMPLOXIKWGERX-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=NC=CS2 |
Computed by PubChem (NCBI)