1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95%
cas: 1333577-52-8 — see every product listed under this CAS number, including other names
1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95% (CAS 1333577-52-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-8628-250mg |
| cas | 1333577-52-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 926.62 Pln | |
| Ambeed | 1g | 2378.44 Pln | |
| Ambeed | 5g | 10394.00 Pln | |
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| Chemat | 5g | 9981.20 Pln | |
| BLDpharm | 100mg | 608.70 Pln | |
| BLDpharm | 250mg | 991.90 Pln | |
| BLDpharm | 1g | 2558.01 Pln | |
| BLDpharm | 5g | 11199.41 Pln | |
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 1g | 4704.61 Pln | |
| Fluorochem | 5g | 18231.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-(2,5-difluorophenyl)propan-1-amine;hydrochloride (CAS 1333577-52-8) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 1-(2,5-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: RXYPROYXZWFRHT-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | RXYPROYXZWFRHT-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)