Products 57799-43-6
CAS 57799-43-6 is the registry number for 1-(2-Amino-5-(trifluoromethyl)phenyl)ethanone, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-[2-amino-5-(trifluoromethyl)phenyl]ethanone (CAS 57799-43-6) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 1-[2-amino-5-(trifluoromethyl)phenyl]ethanone. InChIKey: LWASJRXWJZTWCD-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 1-[2-amino-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | LWASJRXWJZTWCD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)