CAS 75703-25-2 is the registry number for 2,2,2-Trifluoro-1-(p-tolyl)ethanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(NE)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]hydroxylamine (CAS 75703-25-2) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: (NE)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]hydroxylamine. InChIKey: HWQOIGLJELXUJT-MDWZMJQESA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | (NE)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]hydroxylamine |
| InChIKey | HWQOIGLJELXUJT-MDWZMJQESA-N |
| SMILES | CC1=CC=C(C=C1)/C(=N\O)/C(F)(F)F |
Computed by PubChem (NCBI)