CAS 205582-83-8 appears in our catalog under these names: 3-Acetyl-2-methyl-6-(trifluoromethyl)pyridine, 95%, 1-(2-Methyl-6-(trifluoromethyl)pyridin-3-yl)ethanone, 95+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone (CAS 205582-83-8) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone. InChIKey: SLRPZQQYFZSWBO-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone |
| InChIKey | SLRPZQQYFZSWBO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(F)(F)F)C(=O)C |
Computed by PubChem (NCBI)