Products 261952-00-5
CAS 261952-00-5 appears in our catalog under these names: 4-Methyl-3-(trifluoromethyl)benzamide, 98%, 4-Methyl-3-(trifluoromethyl)benzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 10g, 5g.
4-methyl-3-(trifluoromethyl)benzamide (CAS 261952-00-5) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 4-methyl-3-(trifluoromethyl)benzamide. InChIKey: IELCRNVRCVJVGU-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 4-methyl-3-(trifluoromethyl)benzamide |
| InChIKey | IELCRNVRCVJVGU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)