CAS 2727-69-7 is the registry number for 2,2,2-Trifluoro-n-(3-methylphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2,2,2-trifluoro-N-(3-methylphenyl)acetamide (CAS 2727-69-7) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 2,2,2-trifluoro-N-(3-methylphenyl)acetamide. InChIKey: TYEUVUSAPIDKLP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(3-methylphenyl)acetamide |
| InChIKey | TYEUVUSAPIDKLP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)