cas: 154598-53-5 — see every product listed under this CAS number, including other names
1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone, 97% (CAS 154598-53-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 100mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A608777-250mg |
| cas | 154598-53-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 948.85 Pln | |
| AmBeed | 10g | 9463.93 Pln | |
| AmBeed | 100mg | 603.82 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 841.39 Pln | |
| Fluorochem | 5g | 2403.34 Pln | |
| Fluorochem | 10g | 4267.27 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone (CAS 154598-53-5) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: NOKSRMDODJGCPZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | NOKSRMDODJGCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)