CAS 62926-91-4 appears in our catalog under these names: N-(2-chlorophenyl)-2,2,2-trifluoroacetamide, 95%, N-(2-Chlorophenyl)-2,2,2-trifluoroacetamide, 95-<97%, N-(2-Chlorophenyl)-2,2,2-trifluoroacetamide. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 50g, 100g.
N-(2-chlorophenyl)-2,2,2-trifluoroacetamide (CAS 62926-91-4) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: N-(2-chlorophenyl)-2,2,2-trifluoroacetamide. InChIKey: PVXHGQMYBCEHRD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | N-(2-chlorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | PVXHGQMYBCEHRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)