cas: 132253-56-6 — see every product listed under this CAS number, including other names
1-(2-Bromo-phenyl)-2,5-dimethyl-1H-pyrrole (CAS 132253-56-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015377-1G |
| cas | 132253-56-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 3402.99 Pln |
| delivery time | 3-4 weeks |
|---|
1-(2-bromophenyl)-2,5-dimethylpyrrole (CAS 132253-56-6) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 1-(2-bromophenyl)-2,5-dimethylpyrrole. InChIKey: YPUAFHPQVHBZKH-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2,5-dimethylpyrrole |
| InChIKey | YPUAFHPQVHBZKH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=CC=C2Br)C |
Computed by PubChem (NCBI)