CAS 1361110-66-8 is the registry number for 5-Bromo-1-(cyclopropylmethyl)-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-1-(cyclopropylmethyl)indole (CAS 1361110-66-8) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 5-bromo-1-(cyclopropylmethyl)indole. InChIKey: FIJBOCBONGQGHL-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 5-bromo-1-(cyclopropylmethyl)indole |
| InChIKey | FIJBOCBONGQGHL-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C=CC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)