CAS 127257-87-8 appears in our catalog under these names: 1-(3-Bromophenyl)-2,5-dimethylpyrrole, 98%, 1-(3-Bromophenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g.
1-(3-bromophenyl)-2,5-dimethylpyrrole (CAS 127257-87-8) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 1-(3-bromophenyl)-2,5-dimethylpyrrole. InChIKey: DRFJJKOQBRMRCL-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,5-dimethylpyrrole |
| InChIKey | DRFJJKOQBRMRCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC=C2)Br)C |
Computed by PubChem (NCBI)